dc.contributor | Universidade Estadual Paulista (Unesp) | |
dc.date.accessioned | 2014-05-27T11:27:19Z | |
dc.date.accessioned | 2022-10-05T18:38:15Z | |
dc.date.available | 2014-05-27T11:27:19Z | |
dc.date.available | 2022-10-05T18:38:15Z | |
dc.date.created | 2014-05-27T11:27:19Z | |
dc.date.issued | 2012-12-01 | |
dc.identifier | ECS Transactions, v. 43, n. 1, p. 217-224, 2012. | |
dc.identifier | 1938-5862 | |
dc.identifier | 1938-6737 | |
dc.identifier | http://hdl.handle.net/11449/73848 | |
dc.identifier | 10.1149/1.4704961 | |
dc.identifier | 2-s2.0-84879453937 | |
dc.identifier | 0545046720519536 | |
dc.identifier.uri | http://repositorioslatinoamericanos.uchile.cl/handle/2250/3922824 | |
dc.description.abstract | Copper Pentacyanonitrosylferrate (NCuNP) nanoparticles were prepared in formamide solvent. The material was characterized by Infrared (FTIR), X-Ray Diffraction (XRD) and Ultraviolet-Visible (UV-Vis) Spectroscopy. The Cyclic Voltammogram (CV) the modified graphite paste electrode with NCuNP exhibits two redox couples with (Eθ,)1 = 0.29 and (E θ,)2 = 0.86 V attribute at Cu(I)/Cu (II) and Fe(II)(CN)5NO/Fe(III)(CN) 5NO processes, respectively (KCl = 1.0 mol L-1; v = 20 mV s-1). The redox couple with (Eθ,)2 presents an electrocatalytic response for sulfite. The modified graphite paste electrode gives a linear response of 7.0 × 10-4 to 3.0 × 10-2 mol L-1 (r = 0.998), for sulfite determination with Detection Limit (DL) of 1.76 × 10-3 mol L-1 and an amperometric sensitivity of 3.38 mA/mol L-1 and relative standard desviations ± 3% (n=3). ©The Electrochemical Society. | |
dc.language | eng | |
dc.relation | ECS Transactions | |
dc.relation | 0,225 | |
dc.relation | 0,225 | |
dc.rights | Acesso aberto | |
dc.source | Scopus | |
dc.subject | Amperometric | |
dc.subject | Cyclic voltammograms | |
dc.subject | Detection limits | |
dc.subject | Electrocatalytic response | |
dc.subject | Graphite paste electrode | |
dc.subject | Linear response | |
dc.subject | Modified graphites | |
dc.subject | Voltammetric determination | |
dc.subject | Copper | |
dc.subject | Fourier transform infrared spectroscopy | |
dc.subject | Nanoparticles | |
dc.subject | X ray diffraction | |
dc.subject | Graphite | |
dc.title | Voltammetric determination of sulfite using graphite paste electrode modified with nanoparticles of copper pentacyanonitrosylferrate | |
dc.type | Trabalho apresentado em evento | |